C20H36O — CID 166035430
(3R,4S,4aR,8R,8aR)-3,4,8a-trimethyl-4-[(3S)-3-methylpentyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane] (PubChem CID 166035430) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (3R,4S,4aR,8R,8aR)-3,4,8a-trimethyl-4-[(3S)-3-methylpentyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane].
| Compound Name | (3R,4S,4aR,8R,8aR)-3,4,8a-trimethyl-4-[(3S)-3-methylpentyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane] |
|---|---|
| PubChem CID | 166035430 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (3R,4S,4aR,8R,8aR)-3,4,8a-trimethyl-4-[(3S)-3-methylpentyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane] |
| SMILES | CC[C@H](C)CC[C@@]1(C)[C@H](C)CC[C@]2(C)[C@@H]1CCC[C@]21CO1 |
| InChI | InChI=1S/C20H36O/c1-6-15(2)9-12-18(4)16(3)10-13-19(5)17(18)8-7-11-20(19)14-21-20/h15-17H,6-14H2,1-5H3/t15-,16+,17+,18-,19+,20-/m0/s1 |
| InChIKey | CWEMWAQZCDPIJI-BIEDPOGDSA-N |
| XLogP | 5.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|