C29H50O2 — CID 144689283
(5aR)-3a-(hydroxymethyl)-2,2,5a,5b,8,9,11a-heptamethyl-3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol (PubChem CID 144689283) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is (5aR)-3a-(hydroxymethyl)-2,2,5a,5b,8,9,11a-heptamethyl-3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol.
| Compound Name | (5aR)-3a-(hydroxymethyl)-2,2,5a,5b,8,9,11a-heptamethyl-3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 144689283 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | (5aR)-3a-(hydroxymethyl)-2,2,5a,5b,8,9,11a-heptamethyl-3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol |
| SMILES | CC1C2CCC3(C)C(CCC4C5CC(C)(C)CC5(CO)CC[C@]43C)C2(C)CCC1(C)O |
| InChI | InChI=1S/C29H50O2/c1-19-20-10-11-27(6)23(25(20,4)12-14-28(19,7)31)9-8-21-22-16-24(2,3)17-29(22,18-30)15-13-26(21,27)5/h19-23,30-31H,8-18H2,1-7H3/t19?,20?,21?,22?,23?,25?,26-,27?,28?,29?/m1/s1 |
| InChIKey | QQQQOVKSAWAQLS-HEOPSDDTSA-N |
| XLogP | 6.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |