C23H38N4O3 — CID 109388718
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine (PubChem CID 109388718) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 109388718 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-[[1-(2-methoxyethyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCOC)CC1)NC1CCN(c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C23H38N4O3/c1-5-24-22(25-17-23(8-9-23)10-13-28-2)26-18-6-11-27(12-7-18)19-14-20(29-3)16-21(15-19)30-4/h14-16,18H,5-13,17H2,1-4H3,(H2,24,25,26) |
| InChIKey | HXGTYURHQNPKDB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|