C28H31NO3 — CID 10938901
tert-butyl 2-[(2R,4R)-2-benzhydryl-4-phenyl-1,3-oxazolidin-3-yl]acetate (PubChem CID 10938901) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl 2-[(2R,4R)-2-benzhydryl-4-phenyl-1,3-oxazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,4R)-2-benzhydryl-4-phenyl-1,3-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 10938901 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | tert-butyl 2-[(2R,4R)-2-benzhydryl-4-phenyl-1,3-oxazolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1[C@@H](C(c2ccccc2)c2ccccc2)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H31NO3/c1-28(2,3)32-25(30)19-29-24(21-13-7-4-8-14-21)20-31-27(29)26(22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24,26-27H,19-20H2,1-3H3/t24-,27+/m0/s1 |
| InChIKey | NNLIKPDAMBMQKH-RPLLCQBOSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |