C14H21FN2O2 — CID 109389045
6-fluoro-N-(2-hydroxy-2-propylpentyl)pyridine-2-carboxamide (PubChem CID 109389045) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 6-fluoro-N-(2-hydroxy-2-propylpentyl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-(2-hydroxy-2-propylpentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109389045 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-fluoro-N-(2-hydroxy-2-propylpentyl)pyridine-2-carboxamide |
| SMILES | CCCC(O)(CCC)CNC(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C14H21FN2O2/c1-3-8-14(19,9-4-2)10-16-13(18)11-6-5-7-12(15)17-11/h5-7,19H,3-4,8-10H2,1-2H3,(H,16,18) |
| InChIKey | QEAGLIUQZJSCEJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|