C25H31IN4O — CID 109389545
2-(2,3-diphenylpropyl)-1-ethyl-3-(2-hydroxy-2-pyridin-4-ylethyl)guanidine;hydroiodide (PubChem CID 109389545) has the molecular formula C25H31IN4O and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-(2,3-diphenylpropyl)-1-ethyl-3-(2-hydroxy-2-pyridin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-diphenylpropyl)-1-ethyl-3-(2-hydroxy-2-pyridin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109389545 |
| Molecular Formula | C25H31IN4O |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-(2,3-diphenylpropyl)-1-ethyl-3-(2-hydroxy-2-pyridin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(Cc1ccccc1)c1ccccc1)NCC(O)c1ccncc1.I |
| InChI | InChI=1S/C25H30N4O.HI/c1-2-27-25(29-19-24(30)22-13-15-26-16-14-22)28-18-23(21-11-7-4-8-12-21)17-20-9-5-3-6-10-20;/h3-16,23-24,30H,2,17-19H2,1H3,(H2,27,28,29);1H |
| InChIKey | SJNUTPPYUAETQL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|