C21H24BrNO4 — CID 10938978
methyl 2-[(3S,4S,5R)-2-benzyl-5-(bromomethyl)-4-phenylmethoxy-1,2-oxazolidin-3-yl]acetate (PubChem CID 10938978) has the molecular formula C21H24BrNO4 and a molecular weight of 434.33 g/mol. Its IUPAC name is methyl 2-[(3S,4S,5R)-2-benzyl-5-(bromomethyl)-4-phenylmethoxy-1,2-oxazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,5R)-2-benzyl-5-(bromomethyl)-4-phenylmethoxy-1,2-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 10938978 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | methyl 2-[(3S,4S,5R)-2-benzyl-5-(bromomethyl)-4-phenylmethoxy-1,2-oxazolidin-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1[C@H](OCc2ccccc2)[C@H](CBr)ON1Cc1ccccc1 |
| InChI | InChI=1S/C21H24BrNO4/c1-25-20(24)12-18-21(26-15-17-10-6-3-7-11-17)19(13-22)27-23(18)14-16-8-4-2-5-9-16/h2-11,18-19,21H,12-15H2,1H3/t18-,19-,21-/m0/s1 |
| InChIKey | MPEFUNOKGJBUMA-ZJOUEHCJSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|