C24H31NO4 — CID 11003832
2-[(2S,3S,4R)-1-benzyl-3,4-diethoxypyrrolidin-2-yl]ethyl benzoate (PubChem CID 11003832) has the molecular formula C24H31NO4 and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-1-benzyl-3,4-diethoxypyrrolidin-2-yl]ethyl benzoate.
| Compound Name | 2-[(2S,3S,4R)-1-benzyl-3,4-diethoxypyrrolidin-2-yl]ethyl benzoate |
|---|---|
| PubChem CID | 11003832 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[(2S,3S,4R)-1-benzyl-3,4-diethoxypyrrolidin-2-yl]ethyl benzoate |
| SMILES | CCO[C@@H]1[C@H](OCC)CN(Cc2ccccc2)[C@H]1CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H31NO4/c1-3-27-22-18-25(17-19-11-7-5-8-12-19)21(23(22)28-4-2)15-16-29-24(26)20-13-9-6-10-14-20/h5-14,21-23H,3-4,15-18H2,1-2H3/t21-,22+,23-/m0/s1 |
| InChIKey | KJYSROLZBBNYGM-ZRBLBEILSA-N |
| XLogP | 3.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |