C15H19NO3 — CID 44566992
[(3S,6S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] benzoate (PubChem CID 44566992) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(3S,6S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] benzoate.
| Compound Name | [(3S,6S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
|---|---|
| PubChem CID | 44566992 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [(3S,6S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
| SMILES | CN1C2C[C@H](O)CC1[C@@H](OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H19NO3/c1-16-11-7-12(17)9-13(16)14(8-11)19-15(18)10-5-3-2-4-6-10/h2-6,11-14,17H,7-9H2,1H3/t11?,12-,13?,14-/m0/s1 |
| InChIKey | KQVOSDJOQFJEOB-YIOUJQMASA-N |
| XLogP | 1.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |