C23H39NO5Si — CID 10939048
benzyl N-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yloxy)butan-2-yl]carbamate (PubChem CID 10939048) has the molecular formula C23H39NO5Si and a molecular weight of 437.65 g/mol. Its IUPAC name is benzyl N-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yloxy)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yloxy)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 10939048 |
| Molecular Formula | C23H39NO5Si |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | benzyl N-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yloxy)butan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](COC1CCCCO1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H39NO5Si/c1-23(2,3)30(4,5)29-16-14-20(18-27-21-13-9-10-15-26-21)24-22(25)28-17-19-11-7-6-8-12-19/h6-8,11-12,20-21H,9-10,13-18H2,1-5H3,(H,24,25)/t20-,21?/m0/s1 |
| InChIKey | MVUBZWKFDHFDQP-BGERDNNASA-N |
| XLogP | 5.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|