C26H40FNO5 — CID 58123235
tert-butyl N-[(2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate (PubChem CID 58123235) has the molecular formula C26H40FNO5 and a molecular weight of 465.61 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58123235 |
| Molecular Formula | C26H40FNO5 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxypent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](F)[C@H](CO[C@@H]1OC(COCc2ccccc2)[C@H](C)[C@H](C)C1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40FNO5/c1-8-21(27)22(28-25(29)33-26(5,6)7)15-31-24-19(4)17(2)18(3)23(32-24)16-30-14-20-12-10-9-11-13-20/h8-13,17-19,21-24H,1,14-16H2,2-7H3,(H,28,29)/t17-,18+,19?,21+,22-,23?,24+/m0/s1 |
| InChIKey | OOCWVKHQMMPFOJ-HMUGNCTOSA-N |
| XLogP | 5.27 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|