C26H40FNO4 — CID 58123196
N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide (PubChem CID 58123196) has the molecular formula C26H40FNO4 and a molecular weight of 449.61 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide.
| Compound Name | N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide |
|---|---|
| PubChem CID | 58123196 |
| Molecular Formula | C26H40FNO4 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]propanamide |
| SMILES | CC/C=C/[C@@H](F)[C@H](CO[C@@H]1OC(COCc2ccccc2)[C@H](C)[C@H](C)C1C)NC(=O)CC |
| InChI | InChI=1S/C26H40FNO4/c1-6-8-14-22(27)23(28-25(29)7-2)16-31-26-20(5)18(3)19(4)24(32-26)17-30-15-21-12-10-9-11-13-21/h8-14,18-20,22-24,26H,6-7,15-17H2,1-5H3,(H,28,29)/b14-8+/t18-,19+,20?,22+,23-,24?,26+/m0/s1 |
| InChIKey | NTMNTDSKXDHIEA-MRIBJTSGSA-N |
| XLogP | 5.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|