C28H44FNO5 — CID 58123231
tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate (PubChem CID 58123231) has the molecular formula C28H44FNO5 and a molecular weight of 493.66 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58123231 |
| Molecular Formula | C28H44FNO5 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | tert-butyl N-[(E,2S,3R)-3-fluoro-1-[(2R,4S,5R)-3,4,5-trimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]carbamate |
| SMILES | CC/C=C/[C@@H](F)[C@H](CO[C@@H]1OC(COCc2ccccc2)[C@H](C)[C@H](C)C1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H44FNO5/c1-8-9-15-23(29)24(30-27(31)35-28(5,6)7)17-33-26-21(4)19(2)20(3)25(34-26)18-32-16-22-13-11-10-12-14-22/h9-15,19-21,23-26H,8,16-18H2,1-7H3,(H,30,31)/b15-9+/t19-,20+,21?,23+,24-,25?,26+/m0/s1 |
| InChIKey | XGDGCWFRELPPHB-PQQDPFKASA-N |
| XLogP | 6.05 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|