C27H29N5O — CID 10939085
(6aR,8S)-8-tert-butyl-2-ethoxy-4-phenyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine-3,6,6-tricarbonitrile (PubChem CID 10939085) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is (6aR,8S)-8-tert-butyl-2-ethoxy-4-phenyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine-3,6,6-tricarbonitrile.
| Compound Name | (6aR,8S)-8-tert-butyl-2-ethoxy-4-phenyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine-3,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 10939085 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (6aR,8S)-8-tert-butyl-2-ethoxy-4-phenyl-5,6a,7,8,9,10-hexahydropyrido[1,2-a][1,8]naphthyridine-3,6,6-tricarbonitrile |
| SMILES | CCOc1nc2c(c(-c3ccccc3)c1C#N)CC(C#N)(C#N)[C@H]1C[C@@H](C(C)(C)C)CCN21 |
| InChI | InChI=1S/C27H29N5O/c1-5-33-25-21(15-28)23(18-9-7-6-8-10-18)20-14-27(16-29,17-30)22-13-19(26(2,3)4)11-12-32(22)24(20)31-25/h6-10,19,22H,5,11-14H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | GPCKHHAGPXCGQT-SIKLNZKXSA-N |
| XLogP | 5.24 |
| TPSA | 96.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |