C24H15N3O2 — CID 15261533
2-ethoxy-6-oxo-4-phenylindeno[1,2-b][1,8]naphthyridine-3-carbonitrile (PubChem CID 15261533) has the molecular formula C24H15N3O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-ethoxy-6-oxo-4-phenylindeno[1,2-b][1,8]naphthyridine-3-carbonitrile.
| Compound Name | 2-ethoxy-6-oxo-4-phenylindeno[1,2-b][1,8]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 15261533 |
| Molecular Formula | C24H15N3O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-ethoxy-6-oxo-4-phenylindeno[1,2-b][1,8]naphthyridine-3-carbonitrile |
| SMILES | CCOc1nc2nc3c(cc2c(-c2ccccc2)c1C#N)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C24H15N3O2/c1-2-29-24-19(13-25)20(14-8-4-3-5-9-14)17-12-18-21(26-23(17)27-24)15-10-6-7-11-16(15)22(18)28/h3-12H,2H2,1H3 |
| InChIKey | FXLBRZGMVZMRHR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|