C29H25N7O — CID 14936511
2-ethoxy-4-phenyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile (PubChem CID 14936511) has the molecular formula C29H25N7O and a molecular weight of 487.57 g/mol. Its IUPAC name is 2-ethoxy-4-phenyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile.
| Compound Name | 2-ethoxy-4-phenyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 14936511 |
| Molecular Formula | C29H25N7O |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-ethoxy-4-phenyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
| SMILES | CCOc1nc2nc3ccnc(N4CCN(c5ccccn5)CC4)c3cc2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C29H25N7O/c1-2-37-29-23(19-30)26(20-8-4-3-5-9-20)22-18-21-24(33-27(22)34-29)11-13-32-28(21)36-16-14-35(15-17-36)25-10-6-7-12-31-25/h3-13,18H,2,14-17H2,1H3 |
| InChIKey | XAUABCZLIUIQGY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 91.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|