C28H31N5 — CID 11048406
8-phenyl-2-propyl-6-(4-pyridin-2-ylpiperazin-1-yl)-3,4-dihydro-1H-isoquinoline-5-carbonitrile (PubChem CID 11048406) has the molecular formula C28H31N5 and a molecular weight of 437.59 g/mol. Its IUPAC name is 8-phenyl-2-propyl-6-(4-pyridin-2-ylpiperazin-1-yl)-3,4-dihydro-1H-isoquinoline-5-carbonitrile.
| Compound Name | 8-phenyl-2-propyl-6-(4-pyridin-2-ylpiperazin-1-yl)-3,4-dihydro-1H-isoquinoline-5-carbonitrile |
|---|---|
| PubChem CID | 11048406 |
| Molecular Formula | C28H31N5 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 8-phenyl-2-propyl-6-(4-pyridin-2-ylpiperazin-1-yl)-3,4-dihydro-1H-isoquinoline-5-carbonitrile |
| SMILES | CCCN1CCc2c(C#N)c(N3CCN(c4ccccn4)CC3)cc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C28H31N5/c1-2-13-31-14-11-23-25(20-29)27(19-24(26(23)21-31)22-8-4-3-5-9-22)32-15-17-33(18-16-32)28-10-6-7-12-30-28/h3-10,12,19H,2,11,13-18,21H2,1H3 |
| InChIKey | VQDICNUBVYKXMR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|