C29H24N4O5 — CID 10994790
2-ethoxy-6-oxo-4-phenyl-7-(3,4,5-trimethoxyphenyl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile (PubChem CID 10994790) has the molecular formula C29H24N4O5 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-ethoxy-6-oxo-4-phenyl-7-(3,4,5-trimethoxyphenyl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile.
| Compound Name | 2-ethoxy-6-oxo-4-phenyl-7-(3,4,5-trimethoxyphenyl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10994790 |
| Molecular Formula | C29H24N4O5 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-ethoxy-6-oxo-4-phenyl-7-(3,4,5-trimethoxyphenyl)pyrido[4,3-b][1,8]naphthyridine-3-carbonitrile |
| SMILES | CCOc1nc2nc3ccn(-c4cc(OC)c(OC)c(OC)c4)c(=O)c3cc2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C29H24N4O5/c1-5-38-28-21(16-30)25(17-9-7-6-8-10-17)20-15-19-22(31-27(20)32-28)11-12-33(29(19)34)18-13-23(35-2)26(37-4)24(14-18)36-3/h6-15H,5H2,1-4H3 |
| InChIKey | OFIRPMOBPBPYEQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 108.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|