C19H37N5O3 — CID 109391206
tert-butyl N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate (PubChem CID 109391206) has the molecular formula C19H37N5O3 and a molecular weight of 383.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109391206 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | tert-butyl N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CC/N=C(\NCC)N1CCN(C(C)=O)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H37N5O3/c1-7-10-24(18(26)27-19(4,5)6)11-9-21-17(20-8-2)23-14-12-22(13-15-23)16(3)25/h7-15H2,1-6H3,(H,20,21) |
| InChIKey | ACRICVYTUPVTBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|