C16H21Cl2N3O — CID 109391708
1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine (PubChem CID 109391708) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109391708 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCC1=CCOCC1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O/c1-19-16(20-7-4-12-5-8-22-9-6-12)21-11-13-2-3-14(17)10-15(13)18/h2-3,5,10H,4,6-9,11H2,1H3,(H2,19,20,21) |
| InChIKey | AHYHYTWNSGELTI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|