C16H23IN6O — CID 109391385
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109391385) has the molecular formula C16H23IN6O and a molecular weight of 442.31 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109391385 |
| Molecular Formula | C16H23IN6O |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C16H22N6O.HI/c1-17-16(18-8-5-13-6-10-23-11-7-13)19-12-15-21-20-14-4-2-3-9-22(14)15;/h2-4,6,9H,5,7-8,10-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | UGVBFEKZWHYQET-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|