C16H22Cl2IN3O — CID 109391707
1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 109391707) has the molecular formula C16H22Cl2IN3O and a molecular weight of 470.18 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109391707 |
| Molecular Formula | C16H22Cl2IN3O |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H21Cl2N3O.HI/c1-19-16(20-7-4-12-5-8-22-9-6-12)21-11-13-2-3-14(17)10-15(13)18;/h2-3,5,10H,4,6-9,11H2,1H3,(H2,19,20,21);1H |
| InChIKey | OBBVGVLCUYYTBW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|