C15H25IN4OS — CID 109393393
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109393393) has the molecular formula C15H25IN4OS and a molecular weight of 436.36 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393393 |
| Molecular Formula | C15H25IN4OS |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCC1=CCOCC1)NCc1nc(C)c(C)s1.I |
| InChI | InChI=1S/C15H24N4OS.HI/c1-11-12(2)21-14(19-11)10-18-15(16-3)17-7-4-13-5-8-20-9-6-13;/h5H,4,6-10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | UMPCJPOPWRTAHS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|