C19H26FN3O — CID 109392168
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine (PubChem CID 109392168) has the molecular formula C19H26FN3O and a molecular weight of 331.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
|---|---|
| PubChem CID | 109392168 |
| Molecular Formula | C19H26FN3O |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
| SMILES | C/N=C(/NC1C2CCOC2C12CCC2)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN3O/c1-21-18(23(2)12-13-4-6-14(20)7-5-13)22-16-15-8-11-24-17(15)19(16)9-3-10-19/h4-7,15-17H,3,8-12H2,1-2H3,(H,21,22) |
| InChIKey | KGDQOYCYLNXOBD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|