C19H33N3O — CID 109483615
1-hept-6-enyl-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine (PubChem CID 109483615) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
|---|---|
| PubChem CID | 109483615 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C19H33N3O/c1-4-5-6-7-8-13-22(3)18(20-2)21-16-15-10-14-23-17(15)19(16)11-9-12-19/h4,15-17H,1,5-14H2,2-3H3,(H,20,21) |
| InChIKey | AOHLYAILDYTAQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|