C13H16N2OS2 — CID 109396328
3-[(thieno[3,2-b]pyridin-6-ylmethylamino)methyl]thiolan-3-ol (PubChem CID 109396328) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-[(thieno[3,2-b]pyridin-6-ylmethylamino)methyl]thiolan-3-ol.
| Compound Name | 3-[(thieno[3,2-b]pyridin-6-ylmethylamino)methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 109396328 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[(thieno[3,2-b]pyridin-6-ylmethylamino)methyl]thiolan-3-ol |
| SMILES | OC1(CNCc2cnc3ccsc3c2)CCSC1 |
| InChI | InChI=1S/C13H16N2OS2/c16-13(2-4-17-9-13)8-14-6-10-5-12-11(15-7-10)1-3-18-12/h1,3,5,7,14,16H,2,4,6,8-9H2 |
| InChIKey | AMXKFKMYDHSUMN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |