C15H20ClNO2S — CID 111629750
3-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]thiolan-3-ol (PubChem CID 111629750) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 3-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]thiolan-3-ol.
| Compound Name | 3-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 111629750 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-[[(3-chloro-4-prop-2-enoxyphenyl)methylamino]methyl]thiolan-3-ol |
| SMILES | C=CCOc1ccc(CNCC2(O)CCSC2)cc1Cl |
| InChI | InChI=1S/C15H20ClNO2S/c1-2-6-19-14-4-3-12(8-13(14)16)9-17-10-15(18)5-7-20-11-15/h2-4,8,17-18H,1,5-7,9-11H2 |
| InChIKey | AZMZBMIFZNDANM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|