C14H18ClF2NO2S — CID 111436680
4-[[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]methyl]thian-4-ol (PubChem CID 111436680) has the molecular formula C14H18ClF2NO2S and a molecular weight of 337.82 g/mol. Its IUPAC name is 4-[[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]methyl]thian-4-ol.
| Compound Name | 4-[[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]methyl]thian-4-ol |
|---|---|
| PubChem CID | 111436680 |
| Molecular Formula | C14H18ClF2NO2S |
| Molecular Weight | 337.82 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-[[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]methyl]thian-4-ol |
| SMILES | OC1(CNCc2ccc(OC(F)F)c(Cl)c2)CCSCC1 |
| InChI | InChI=1S/C14H18ClF2NO2S/c15-11-7-10(1-2-12(11)20-13(16)17)8-18-9-14(19)3-5-21-6-4-14/h1-2,7,13,18-19H,3-6,8-9H2 |
| InChIKey | JVONOXIYOBOBNW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |