C13H16F3NO3 — CID 109396406
[3-[[[4-(difluoromethoxy)-3-fluorophenyl]methylamino]methyl]oxetan-3-yl]methanol (PubChem CID 109396406) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is [3-[[[4-(difluoromethoxy)-3-fluorophenyl]methylamino]methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[[[4-(difluoromethoxy)-3-fluorophenyl]methylamino]methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 109396406 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | [3-[[[4-(difluoromethoxy)-3-fluorophenyl]methylamino]methyl]oxetan-3-yl]methanol |
| SMILES | OCC1(CNCc2ccc(OC(F)F)c(F)c2)COC1 |
| InChI | InChI=1S/C13H16F3NO3/c14-10-3-9(1-2-11(10)20-12(15)16)4-17-5-13(6-18)7-19-8-13/h1-3,12,17-18H,4-8H2 |
| InChIKey | VWTCKNOXAHMMAN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |