About 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea
1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 109397206) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea.
Molecular Properties
| Compound Name | 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| PubChem CID | 109397206 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | CCc1noc(C)c1NC(=O)NCCCC(C)(C)CO |
| InChI | InChI=1S/C14H25N3O3/c1-5-11-12(10(2)20-17-11)16-13(19)15-8-6-7-14(3,4)9-18/h18H,5-9H2,1-4H3,(H2,15,16,19) |
| InChIKey | NQXIMRHRGPYMGY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea?
The IUPAC name of 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea (CID 109397206) is 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea.
What is the SMILES notation for 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea?
The canonical SMILES for 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea is CCc1noc(C)c1NC(=O)NCCCC(C)(C)CO.
What is the InChIKey of 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea?
The InChIKey is NQXIMRHRGPYMGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3/c1-5-11-12(10(2)20-17-11)16-13(19)15-8-6-7-14(3,4)9-18/h18H,5-9H2,1-4H3,(H2,15,16,19).
What are the key properties of 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea?
1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea has a molecular weight of 283.37 g/mol, XLogP of 2.47, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-5-methyl-1,2-oxazol-4-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea is sourced from PubChem (CID 109397206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).