C13H23N3O3 — CID 111486789
1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea (PubChem CID 111486789) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea.
| Compound Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111486789 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(5-hydroxy-4,4-dimethylpentyl)urea |
| SMILES | Cc1nc(NC(=O)NCCCC(C)(C)CO)oc1C |
| InChI | InChI=1S/C13H23N3O3/c1-9-10(2)19-12(15-9)16-11(18)14-7-5-6-13(3,4)8-17/h17H,5-8H2,1-4H3,(H2,14,15,16,18) |
| InChIKey | BHIDUURRKYDDAE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|