C10H17N3O3 — CID 111336661
1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(3-hydroxybutyl)urea (PubChem CID 111336661) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(3-hydroxybutyl)urea.
| Compound Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(3-hydroxybutyl)urea |
|---|---|
| PubChem CID | 111336661 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(3-hydroxybutyl)urea |
| SMILES | Cc1nc(NC(=O)NCCC(C)O)oc1C |
| InChI | InChI=1S/C10H17N3O3/c1-6(14)4-5-11-9(15)13-10-12-7(2)8(3)16-10/h6,14H,4-5H2,1-3H3,(H2,11,12,13,15) |
| InChIKey | WVMMGQBCZGFKCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |