C18H35N3O2 — CID 109397601
3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea (PubChem CID 109397601) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea.
| Compound Name | 3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 109397601 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
| SMILES | CC1CC(C)CN(CCCNC(=O)N(C)CC2CCCC2O)C1 |
| InChI | InChI=1S/C18H35N3O2/c1-14-10-15(2)12-21(11-14)9-5-8-19-18(23)20(3)13-16-6-4-7-17(16)22/h14-17,22H,4-13H2,1-3H3,(H,19,23) |
| InChIKey | RDUCUGPHOPGSHJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|