C19H35N3O2 — CID 78891727
1-cyclopropyl-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(oxolan-3-ylmethyl)urea (PubChem CID 78891727) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(oxolan-3-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(oxolan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 78891727 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 1-cyclopropyl-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(oxolan-3-ylmethyl)urea |
| SMILES | CC1CC(C)CN(CCCNC(=O)N(CC2CCOC2)C2CC2)C1 |
| InChI | InChI=1S/C19H35N3O2/c1-15-10-16(2)12-21(11-15)8-3-7-20-19(23)22(18-4-5-18)13-17-6-9-24-14-17/h15-18H,3-14H2,1-2H3,(H,20,23) |
| InChIKey | ZSELKTRLXCSONG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|