C28H54O3Si3 — CID 10940310
3-[tert-butyl(dimethyl)silyl]-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dihydropentalen-2-one (PubChem CID 10940310) has the molecular formula C28H54O3Si3 and a molecular weight of 523.00 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dihydropentalen-2-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dihydropentalen-2-one |
|---|---|
| PubChem CID | 10940310 |
| Molecular Formula | C28H54O3Si3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-5,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dihydropentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CO[Si](C)(C)C(C)(C)C)C=C2CC(=O)C([Si](C)(C)C(C)(C)C)=C2C1 |
| InChI | InChI=1S/C28H54O3Si3/c1-25(2,3)32(10,11)24-22-18-28(17-21(22)16-23(24)29,19-30-33(12,13)26(4,5)6)20-31-34(14,15)27(7,8)9/h17H,16,18-20H2,1-15H3 |
| InChIKey | LMUGPMHKWQJLNX-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|