C24H35IN4O — CID 109403940
1-ethyl-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 109403940) has the molecular formula C24H35IN4O and a molecular weight of 522.48 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109403940 |
| Molecular Formula | C24H35IN4O |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCOC1c1ccc(C)cc1)NCCc1ccncc1C.I |
| InChI | InChI=1S/C24H34N4O.HI/c1-4-26-24(27-14-12-20-11-13-25-16-19(20)3)28-17-22-6-5-15-29-23(22)21-9-7-18(2)8-10-21;/h7-11,13,16,22-23H,4-6,12,14-15,17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | XCKSJKKVVAYRRO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|