C24H37IN4OS — CID 111620643
1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111620643) has the molecular formula C24H37IN4OS and a molecular weight of 556.56 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620643 |
| Molecular Formula | C24H37IN4OS |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCOC1c1ccc(C)cc1)NCCc1nc(CC)c(C)s1.I |
| InChI | InChI=1S/C24H36N4OS.HI/c1-5-21-18(4)30-22(28-21)13-14-26-24(25-6-2)27-16-20-8-7-15-29-23(20)19-11-9-17(3)10-12-19;/h9-12,20,23H,5-8,13-16H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | ZXRFDCURLKZCNF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|