About diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate
diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate (PubChem CID 10940554) has the molecular formula C24H21BrN2O6S
and a molecular weight of 545.41 g/mol. Its IUPAC name is diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate |
| PubChem CID | 10940554 |
| Molecular Formula | C24H21BrN2O6S |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(NC(=S)NC(=O)c3ccccc3)c(Br)cc-2c(C(=O)OCC)c1O |
| InChI | InChI=1S/C24H21BrN2O6S/c1-3-32-22(30)18-14-10-11-17(26-24(34)27-21(29)13-8-6-5-7-9-13)16(25)12-15(14)19(20(18)28)23(31)33-4-2/h5-12,28H,3-4H2,1-2H3,(H2,26,27,29,34) |
| InChIKey | FVEGZFMXWMEEHQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate?
The IUPAC name of diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate (CID 10940554) is diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate.
What is the SMILES notation for diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate?
The canonical SMILES for diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate is CCOC(=O)c1c2ccc(NC(=S)NC(=O)c3ccccc3)c(Br)cc-2c(C(=O)OCC)c1O.
What is the InChIKey of diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate?
The InChIKey is FVEGZFMXWMEEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21BrN2O6S/c1-3-32-22(30)18-14-10-11-17(26-24(34)27-21(29)13-8-6-5-7-9-13)16(25)12-15(14)19(20(18)28)23(31)33-4-2/h5-12,28H,3-4H2,1-2H3,(H2,26,27,29,34).
What are the key properties of diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate?
diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate has a molecular weight of 545.41 g/mol, XLogP of 4.74, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-(benzoylcarbamothioylamino)-5-bromo-2-hydroxyazulene-1,3-dicarboxylate is sourced from PubChem (CID 10940554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).