C21H38N6O — CID 109406194
N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 109406194) has the molecular formula C21H38N6O and a molecular weight of 390.58 g/mol. Its IUPAC name is N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 109406194 |
| Molecular Formula | C21H38N6O |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)N1CCC(CN2CCOCC2)C1 |
| InChI | InChI=1S/C21H38N6O/c1-5-19-18(20(6-2)25(4)24-19)14-23-21(22-7-3)27-9-8-17(16-27)15-26-10-12-28-13-11-26/h17H,5-16H2,1-4H3,(H,22,23) |
| InChIKey | XSXZYQIAXDVFHW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|