C22H38N6 — CID 109406440
4-(2-bicyclo[2.2.1]heptanyl)-N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 109406440) has the molecular formula C22H38N6 and a molecular weight of 386.59 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanyl)-N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanyl)-N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109406440 |
| Molecular Formula | C22H38N6 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanyl)-N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)N1CCN(C2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C22H38N6/c1-5-19-18(20(6-2)26(4)25-19)15-24-22(23-3)28-11-9-27(10-12-28)21-14-16-7-8-17(21)13-16/h16-17,21H,5-15H2,1-4H3,(H,23,24) |
| InChIKey | SDRSPJCEOKMWGI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|