C23H39N5O3 — CID 109407442
tert-butyl N-[3-[1-[N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]carbamimidoyl]piperidin-4-yl]oxypropyl]carbamate (PubChem CID 109407442) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is tert-butyl N-[3-[1-[N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]carbamimidoyl]piperidin-4-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-[N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]carbamimidoyl]piperidin-4-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 109407442 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | tert-butyl N-[3-[1-[N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]carbamimidoyl]piperidin-4-yl]oxypropyl]carbamate |
| SMILES | C/N=C(\NCCc1ccncc1C)N1CCC(OCCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H39N5O3/c1-18-17-25-12-7-19(18)8-13-26-21(24-5)28-14-9-20(10-15-28)30-16-6-11-27-22(29)31-23(2,3)4/h7,12,17,20H,6,8-11,13-16H2,1-5H3,(H,24,26)(H,27,29) |
| InChIKey | CZGGVNPDMUXAOY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|