C23H33IN4O2 — CID 109407496
1-ethyl-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109407496) has the molecular formula C23H33IN4O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 1-ethyl-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109407496 |
| Molecular Formula | C23H33IN4O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 1-ethyl-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CC(=O)Nc2ccccc21)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C23H32N4O2.HI/c1-2-24-22(25-14-15-13-19(28)26-18-8-4-3-7-16(15)18)27-20-17-9-12-29-21(17)23(20)10-5-6-11-23;/h3-4,7-8,15,17,20-21H,2,5-6,9-14H2,1H3,(H,26,28)(H2,24,25,27);1H |
| InChIKey | CKZGJXNXIQVPPR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|