C19H23ClIN3O3 — CID 109409986
1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109409986) has the molecular formula C19H23ClIN3O3 and a molecular weight of 503.77 g/mol. Its IUPAC name is 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109409986 |
| Molecular Formula | C19H23ClIN3O3 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(Cl)c2c(c1)OCO2)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C19H22ClN3O3.HI/c1-21-19(23-10-15(11-24)14-5-3-2-4-6-14)22-9-13-7-16(20)18-17(8-13)25-12-26-18;/h2-8,15,24H,9-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | DPLSONOUYZLXDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|