C19H19FN2O2 — CID 109411586
1-[(2-fluorophenyl)methoxy]-3-(4-phenylpyrazol-1-yl)propan-2-ol (PubChem CID 109411586) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-3-(4-phenylpyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-3-(4-phenylpyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 109411586 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-3-(4-phenylpyrazol-1-yl)propan-2-ol |
| SMILES | OC(COCc1ccccc1F)Cn1cc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C19H19FN2O2/c20-19-9-5-4-8-16(19)13-24-14-18(23)12-22-11-17(10-21-22)15-6-2-1-3-7-15/h1-11,18,23H,12-14H2 |
| InChIKey | OMWYWUMMAISTEO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |