C20H25N3O2S — CID 109418962
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine (PubChem CID 109418962) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109418962 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1oc2ccccc2c1C)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C20H25N3O2S/c1-4-21-19(23-13-20(3,24)18-10-7-11-26-18)22-12-17-14(2)15-8-5-6-9-16(15)25-17/h5-11,24H,4,12-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | ZOPGOIWLAIAVFV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|