C19H24N6O2S — CID 109419580
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine (PubChem CID 109419580) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109419580 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCc1noc(-c2ccccn2)n1 |
| InChI | InChI=1S/C19H24N6O2S/c1-3-20-18(23-13-19(2,26)15-8-6-12-28-15)22-11-9-16-24-17(27-25-16)14-7-4-5-10-21-14/h4-8,10,12,26H,3,9,11,13H2,1-2H3,(H2,20,22,23) |
| InChIKey | ZEEBUULHDWZMBB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|