C17H31N5OS — CID 109424800
2-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424800) has the molecular formula C17H31N5OS and a molecular weight of 353.54 g/mol. Its IUPAC name is 2-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424800 |
| Molecular Formula | C17H31N5OS |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CCN(CCOC)C1CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H31N5OS/c1-5-18-17(21(3)12-15-13-24-14(2)20-15)19-8-9-22(10-11-23-4)16-6-7-16/h13,16H,5-12H2,1-4H3,(H,18,19) |
| InChIKey | BDCLWJBAXJLGOM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|