C22H34N4O2 — CID 109425898
N-cyclohexyl-3-[[N-methyl-C-(4-phenoxypiperidin-1-yl)carbonimidoyl]amino]propanamide (PubChem CID 109425898) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N-methyl-C-(4-phenoxypiperidin-1-yl)carbonimidoyl]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[N-methyl-C-(4-phenoxypiperidin-1-yl)carbonimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109425898 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N-cyclohexyl-3-[[N-methyl-C-(4-phenoxypiperidin-1-yl)carbonimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCCCC1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-23-22(24-15-12-21(27)25-18-8-4-2-5-9-18)26-16-13-20(14-17-26)28-19-10-6-3-7-11-19/h3,6-7,10-11,18,20H,2,4-5,8-9,12-17H2,1H3,(H,23,24)(H,25,27) |
| InChIKey | NVKNDPZFPQAGHZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|