C19H23N5OS — CID 109428647
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 109428647) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109428647 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H23N5OS/c1-4-20-19(21-10-17-23-13(2)14(3)25-17)22-11-18-24-16(12-26-18)15-8-6-5-7-9-15/h5-9,12H,4,10-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | BZKKOAAURYBVKK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|