C19H22N4S2 — CID 111893179
1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111893179) has the molecular formula C19H22N4S2 and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111893179 |
| Molecular Formula | C19H22N4S2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1sccc1C)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H22N4S2/c1-3-20-19(21-11-17-14(2)9-10-24-17)22-12-18-23-16(13-25-18)15-7-5-4-6-8-15/h4-10,13H,3,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | KHHNYCBBMDBLFR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|